C28H32ClF2N8OS+ — CID 163556476
CID 163556476 (PubChem CID 163556476) has the molecular formula C28H32ClF2N8OS+ and a molecular weight of 602.14 g/mol.
| Compound Name | CID 163556476 |
|---|---|
| PubChem CID | 163556476 |
| Molecular Formula | C28H32ClF2N8OS+ |
| Molecular Weight | 602.14 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | — |
| SMILES | CC1CN(c2ncc(Nc3ncc4ccn(-c5cc(F)c(CN6CC[SH+](=O)CC6)c(F)c5)c4n3)cc2Cl)CC(C)N1 |
| InChI | InChI=1S/C28H31ClF2N8OS/c1-17-14-38(15-18(2)34-17)27-23(29)9-20(13-32-27)35-28-33-12-19-3-4-39(26(19)36-28)21-10-24(30)22(25(31)11-21)16-37-5-7-41(40)8-6-37/h3-4,9-13,17-18,34H,5-8,14-16H2,1-2H3,(H,33,35,36)/p+1 |
| InChIKey | FNMNBUILTUJYKX-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.14 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|