C24H23ClFN5O2S — CID 68990060
[4-[2-(3-chloro-4-methylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]-2-fluorophenyl]-thiomorpholin-4-ylmethanediol (PubChem CID 68990060) has the molecular formula C24H23ClFN5O2S and a molecular weight of 500.00 g/mol. Its IUPAC name is [4-[2-(3-chloro-4-methylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]-2-fluorophenyl]-thiomorpholin-4-ylmethanediol.
| Compound Name | [4-[2-(3-chloro-4-methylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]-2-fluorophenyl]-thiomorpholin-4-ylmethanediol |
|---|---|
| PubChem CID | 68990060 |
| Molecular Formula | C24H23ClFN5O2S |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | [4-[2-(3-chloro-4-methylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]-2-fluorophenyl]-thiomorpholin-4-ylmethanediol |
| SMILES | Cc1ccc(Nc2ncc3ccn(-c4ccc(C(O)(O)N5CCSCC5)c(F)c4)c3n2)cc1Cl |
| InChI | InChI=1S/C24H23ClFN5O2S/c1-15-2-3-17(12-20(15)25)28-23-27-14-16-6-7-31(22(16)29-23)18-4-5-19(21(26)13-18)24(32,33)30-8-10-34-11-9-30/h2-7,12-14,32-33H,8-11H2,1H3,(H,27,28,29) |
| InChIKey | KBVUUNFMSIHAIN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|