C26H28ClN5O3S — CID 68990368
[2-chloro-4-[2-(4-propan-2-yloxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-thiomorpholin-4-ylmethanediol (PubChem CID 68990368) has the molecular formula C26H28ClN5O3S and a molecular weight of 526.06 g/mol. Its IUPAC name is [2-chloro-4-[2-(4-propan-2-yloxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-thiomorpholin-4-ylmethanediol.
| Compound Name | [2-chloro-4-[2-(4-propan-2-yloxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-thiomorpholin-4-ylmethanediol |
|---|---|
| PubChem CID | 68990368 |
| Molecular Formula | C26H28ClN5O3S |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | [2-chloro-4-[2-(4-propan-2-yloxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-thiomorpholin-4-ylmethanediol |
| SMILES | CC(C)Oc1ccc(Nc2ncc3ccn(-c4ccc(C(O)(O)N5CCSCC5)c(Cl)c4)c3n2)cc1 |
| InChI | InChI=1S/C26H28ClN5O3S/c1-17(2)35-21-6-3-19(4-7-21)29-25-28-16-18-9-10-32(24(18)30-25)20-5-8-22(23(27)15-20)26(33,34)31-11-13-36-14-12-31/h3-10,15-17,33-34H,11-14H2,1-2H3,(H,28,29,30) |
| InChIKey | VVOWSWOYAQULEE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|