C22H21N5O5 — CID 11293467
2-amino-5-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzoic acid (PubChem CID 11293467) has the molecular formula C22H21N5O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is 2-amino-5-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzoic acid.
| Compound Name | 2-amino-5-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzoic acid |
|---|---|
| PubChem CID | 11293467 |
| Molecular Formula | C22H21N5O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-amino-5-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzoic acid |
| SMILES | COc1cc(Nc2ncc3ccn(-c4ccc(N)c(C(=O)O)c4)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N5O5/c1-30-17-8-13(9-18(31-2)19(17)32-3)25-22-24-11-12-6-7-27(20(12)26-22)14-4-5-16(23)15(10-14)21(28)29/h4-11H,23H2,1-3H3,(H,28,29)(H,24,25,26) |
| InChIKey | RFDLDTIVCIADBD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|