C24H20F2N6O2S — CID 68990811
4-[[7-[4-[dihydroxy(thiomorpholin-4-yl)methyl]-3,5-difluorophenyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 68990811) has the molecular formula C24H20F2N6O2S and a molecular weight of 494.53 g/mol. Its IUPAC name is 4-[[7-[4-[dihydroxy(thiomorpholin-4-yl)methyl]-3,5-difluorophenyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[7-[4-[dihydroxy(thiomorpholin-4-yl)methyl]-3,5-difluorophenyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 68990811 |
| Molecular Formula | C24H20F2N6O2S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 4-[[7-[4-[dihydroxy(thiomorpholin-4-yl)methyl]-3,5-difluorophenyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2ncc3ccn(-c4cc(F)c(C(O)(O)N5CCSCC5)c(F)c4)c3n2)cc1 |
| InChI | InChI=1S/C24H20F2N6O2S/c25-19-11-18(12-20(26)21(19)24(33,34)31-7-9-35-10-8-31)32-6-5-16-14-28-23(30-22(16)32)29-17-3-1-15(13-27)2-4-17/h1-6,11-12,14,33-34H,7-10H2,(H,28,29,30) |
| InChIKey | NWHGVWGUPAUWTJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|