C20H34N4O5 — CID 163557595
1-[2-[[2-[[(E)-2-ethylpent-3-enoyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid (PubChem CID 163557595) has the molecular formula C20H34N4O5 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[2-[[2-[[(E)-2-ethylpent-3-enoyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid.
| Compound Name | 1-[2-[[2-[[(E)-2-ethylpent-3-enoyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 163557595 |
| Molecular Formula | C20H34N4O5 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 1-[2-[[2-[[(E)-2-ethylpent-3-enoyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid |
| SMILES | C/C=C/C(CC)C(=O)NC(C(=O)NC(C)C(=O)N1CCCC(C(=O)O)N1)C(C)C |
| InChI | InChI=1S/C20H34N4O5/c1-6-9-14(7-2)17(25)22-16(12(3)4)18(26)21-13(5)19(27)24-11-8-10-15(23-24)20(28)29/h6,9,12-16,23H,7-8,10-11H2,1-5H3,(H,21,26)(H,22,25)(H,28,29)/b9-6+ |
| InChIKey | FOLMZNCGZCMTSC-RMKNXTFCSA-N |
| XLogP | 0.81 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|