C22H38N4O5 — CID 123709747
1-[2-[[2-(4,4-dimethylhept-6-enoylamino)-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid (PubChem CID 123709747) has the molecular formula C22H38N4O5 and a molecular weight of 438.57 g/mol. Its IUPAC name is 1-[2-[[2-(4,4-dimethylhept-6-enoylamino)-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid.
| Compound Name | 1-[2-[[2-(4,4-dimethylhept-6-enoylamino)-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 123709747 |
| Molecular Formula | C22H38N4O5 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 1-[2-[[2-(4,4-dimethylhept-6-enoylamino)-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid |
| SMILES | C=CCC(C)(C)CCC(=O)NC(C(=O)NC(C)C(=O)N1CCCC(C(=O)O)N1)C(C)C |
| InChI | InChI=1S/C22H38N4O5/c1-7-11-22(5,6)12-10-17(27)24-18(14(2)3)19(28)23-15(4)20(29)26-13-8-9-16(25-26)21(30)31/h7,14-16,18,25H,1,8-13H2,2-6H3,(H,23,28)(H,24,27)(H,30,31) |
| InChIKey | MTTKUEOBUKIUJB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|