C18H29Cl3N4O6S — CID 123190537
2,2,2-trichloroethyl 1-[2-[[3-methyl-2-(prop-2-enylsulfonylamino)butanoyl]amino]propanoyl]diazinane-3-carboxylate (PubChem CID 123190537) has the molecular formula C18H29Cl3N4O6S and a molecular weight of 535.88 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 1-[2-[[3-methyl-2-(prop-2-enylsulfonylamino)butanoyl]amino]propanoyl]diazinane-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 1-[2-[[3-methyl-2-(prop-2-enylsulfonylamino)butanoyl]amino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 123190537 |
| Molecular Formula | C18H29Cl3N4O6S |
| Molecular Weight | 535.88 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | 2,2,2-trichloroethyl 1-[2-[[3-methyl-2-(prop-2-enylsulfonylamino)butanoyl]amino]propanoyl]diazinane-3-carboxylate |
| SMILES | C=CCS(=O)(=O)NC(C(=O)NC(C)C(=O)N1CCCC(C(=O)OCC(Cl)(Cl)Cl)N1)C(C)C |
| InChI | InChI=1S/C18H29Cl3N4O6S/c1-5-9-32(29,30)24-14(11(2)3)15(26)22-12(4)16(27)25-8-6-7-13(23-25)17(28)31-10-18(19,20)21/h5,11-14,23-24H,1,6-10H2,2-4H3,(H,22,26) |
| InChIKey | JGYRFCGTZHJMKZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.88 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|