C29H50Cl3N3O7Si — CID 123523611
2,2,2-trichloroethyl 1-[2-[[2-[3-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-6-enoyl]oxy-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate (PubChem CID 123523611) has the molecular formula C29H50Cl3N3O7Si and a molecular weight of 687.18 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 1-[2-[[2-[3-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-6-enoyl]oxy-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 1-[2-[[2-[3-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-6-enoyl]oxy-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 123523611 |
| Molecular Formula | C29H50Cl3N3O7Si |
| Molecular Weight | 687.18 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | 2,2,2-trichloroethyl 1-[2-[[2-[3-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-6-enoyl]oxy-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate |
| SMILES | C=CCCC(O[Si](C)(C)C(C)(C)C)C(C)C(=O)OC(C(=O)NC(C)C(=O)N1CCCC(C(=O)OCC(Cl)(Cl)Cl)N1)C(C)C |
| InChI | InChI=1S/C29H50Cl3N3O7Si/c1-11-12-15-22(42-43(9,10)28(6,7)8)19(4)26(38)41-23(18(2)3)24(36)33-20(5)25(37)35-16-13-14-21(34-35)27(39)40-17-29(30,31)32/h11,18-23,34H,1,12-17H2,2-10H3,(H,33,36) |
| InChIKey | ZASRNCUPHGGMFZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.18 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|