C15H24Cl3N3O5 — CID 122448940
2,2,2-trichloroethyl 1-[(2S)-2-[[(2S)-2-hydroxy-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate (PubChem CID 122448940) has the molecular formula C15H24Cl3N3O5 and a molecular weight of 432.73 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 1-[(2S)-2-[[(2S)-2-hydroxy-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 1-[(2S)-2-[[(2S)-2-hydroxy-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 122448940 |
| Molecular Formula | C15H24Cl3N3O5 |
| Molecular Weight | 432.73 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2,2,2-trichloroethyl 1-[(2S)-2-[[(2S)-2-hydroxy-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate |
| SMILES | CC(C)[C@H](O)C(=O)N[C@@H](C)C(=O)N1CCCC(C(=O)OCC(Cl)(Cl)Cl)N1 |
| InChI | InChI=1S/C15H24Cl3N3O5/c1-8(2)11(22)12(23)19-9(3)13(24)21-6-4-5-10(20-21)14(25)26-7-15(16,17)18/h8-11,20,22H,4-7H2,1-3H3,(H,19,23)/t9-,10?,11-/m0/s1 |
| InChIKey | QWCNIJNOBNHZPI-JRUYECLLSA-N |
| XLogP | 0.92 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.73 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|