C9H13Cl3N2O3 — CID 123225420
2,2,2-trichloroethyl 1-acetyldiazinane-3-carboxylate (PubChem CID 123225420) has the molecular formula C9H13Cl3N2O3 and a molecular weight of 303.57 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 1-acetyldiazinane-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 1-acetyldiazinane-3-carboxylate |
|---|---|
| PubChem CID | 123225420 |
| Molecular Formula | C9H13Cl3N2O3 |
| Molecular Weight | 303.57 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 2,2,2-trichloroethyl 1-acetyldiazinane-3-carboxylate |
| SMILES | CC(=O)N1CCCC(C(=O)OCC(Cl)(Cl)Cl)N1 |
| InChI | InChI=1S/C9H13Cl3N2O3/c1-6(15)14-4-2-3-7(13-14)8(16)17-5-9(10,11)12/h7,13H,2-5H2,1H3 |
| InChIKey | PUXMZVHUJIPINW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.57 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|