C18H30Cl3N3O4 — CID 123712065
2,2,2-trichloroethyl 1-[2-(2-propan-2-ylpentanoylamino)propanoyl]diazinane-3-carboxylate (PubChem CID 123712065) has the molecular formula C18H30Cl3N3O4 and a molecular weight of 458.81 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 1-[2-(2-propan-2-ylpentanoylamino)propanoyl]diazinane-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 1-[2-(2-propan-2-ylpentanoylamino)propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 123712065 |
| Molecular Formula | C18H30Cl3N3O4 |
| Molecular Weight | 458.81 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2,2,2-trichloroethyl 1-[2-(2-propan-2-ylpentanoylamino)propanoyl]diazinane-3-carboxylate |
| SMILES | CCCC(C(=O)NC(C)C(=O)N1CCCC(C(=O)OCC(Cl)(Cl)Cl)N1)C(C)C |
| InChI | InChI=1S/C18H30Cl3N3O4/c1-5-7-13(11(2)3)15(25)22-12(4)16(26)24-9-6-8-14(23-24)17(27)28-10-18(19,20)21/h11-14,23H,5-10H2,1-4H3,(H,22,25) |
| InChIKey | UZSJKTCGKKIDFA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.81 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|