C17H32N4O4 — CID 123165659
2-methylpropyl 1-[2-[(2-amino-3-methylbutanoyl)amino]propanoyl]diazinane-3-carboxylate (PubChem CID 123165659) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-methylpropyl 1-[2-[(2-amino-3-methylbutanoyl)amino]propanoyl]diazinane-3-carboxylate.
| Compound Name | 2-methylpropyl 1-[2-[(2-amino-3-methylbutanoyl)amino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 123165659 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-methylpropyl 1-[2-[(2-amino-3-methylbutanoyl)amino]propanoyl]diazinane-3-carboxylate |
| SMILES | CC(C)COC(=O)C1CCCN(C(=O)C(C)NC(=O)C(N)C(C)C)N1 |
| InChI | InChI=1S/C17H32N4O4/c1-10(2)9-25-17(24)13-7-6-8-21(20-13)16(23)12(5)19-15(22)14(18)11(3)4/h10-14,20H,6-9,18H2,1-5H3,(H,19,22) |
| InChIKey | FOZZIZQBLXHVAS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |