C15H27Cl3N4O4 — CID 123198028
2-amino-N-[1-[3-[hydroxy(2,2,2-trichloroethoxy)methyl]diazinan-1-yl]-1-oxopropan-2-yl]-3-methylbutanamide (PubChem CID 123198028) has the molecular formula C15H27Cl3N4O4 and a molecular weight of 433.76 g/mol. Its IUPAC name is 2-amino-N-[1-[3-[hydroxy(2,2,2-trichloroethoxy)methyl]diazinan-1-yl]-1-oxopropan-2-yl]-3-methylbutanamide.
| Compound Name | 2-amino-N-[1-[3-[hydroxy(2,2,2-trichloroethoxy)methyl]diazinan-1-yl]-1-oxopropan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 123198028 |
| Molecular Formula | C15H27Cl3N4O4 |
| Molecular Weight | 433.76 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-amino-N-[1-[3-[hydroxy(2,2,2-trichloroethoxy)methyl]diazinan-1-yl]-1-oxopropan-2-yl]-3-methylbutanamide |
| SMILES | CC(NC(=O)C(N)C(C)C)C(=O)N1CCCC(C(O)OCC(Cl)(Cl)Cl)N1 |
| InChI | InChI=1S/C15H27Cl3N4O4/c1-8(2)11(19)12(23)20-9(3)13(24)22-6-4-5-10(21-22)14(25)26-7-15(16,17)18/h8-11,14,21,25H,4-7,19H2,1-3H3,(H,20,23) |
| InChIKey | MULQYUKOKAQBSY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.76 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|