C11H18Cl3N3O3 — CID 130196086
2,2,2-trichloroethyl (3S)-1-[(2S)-2-(methylamino)propanoyl]diazinane-3-carboxylate (PubChem CID 130196086) has the molecular formula C11H18Cl3N3O3 and a molecular weight of 346.64 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (3S)-1-[(2S)-2-(methylamino)propanoyl]diazinane-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (3S)-1-[(2S)-2-(methylamino)propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 130196086 |
| Molecular Formula | C11H18Cl3N3O3 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2,2,2-trichloroethyl (3S)-1-[(2S)-2-(methylamino)propanoyl]diazinane-3-carboxylate |
| SMILES | CN[C@@H](C)C(=O)N1CCC[C@@H](C(=O)OCC(Cl)(Cl)Cl)N1 |
| InChI | InChI=1S/C11H18Cl3N3O3/c1-7(15-2)9(18)17-5-3-4-8(16-17)10(19)20-6-11(12,13)14/h7-8,15-16H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | KOIARNAYBVTTCH-YUMQZZPRSA-N |
| XLogP | 1.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|