C17H29Cl2IN4O4 — CID 163759901
(2,2-dichloro-2-iodoethyl) 1-[2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoyl]diazinane-3-carboxylate (PubChem CID 163759901) has the molecular formula C17H29Cl2IN4O4 and a molecular weight of 551.25 g/mol. Its IUPAC name is (2,2-dichloro-2-iodoethyl) 1-[2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoyl]diazinane-3-carboxylate.
| Compound Name | (2,2-dichloro-2-iodoethyl) 1-[2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 163759901 |
| Molecular Formula | C17H29Cl2IN4O4 |
| Molecular Weight | 551.25 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | (2,2-dichloro-2-iodoethyl) 1-[2-[(2-amino-3-methylbutanoyl)amino]-3-methylbutanoyl]diazinane-3-carboxylate |
| SMILES | CC(C)C(N)C(=O)NC(C(=O)N1CCCC(C(=O)OCC(Cl)(Cl)I)N1)C(C)C |
| InChI | InChI=1S/C17H29Cl2IN4O4/c1-9(2)12(21)14(25)22-13(10(3)4)15(26)24-7-5-6-11(23-24)16(27)28-8-17(18,19)20/h9-13,23H,5-8,21H2,1-4H3,(H,22,25) |
| InChIKey | LXHUBHXGXIXOGJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|