C22H39N5O4 — CID 163700718
(3S)-1-[(2S)-2-[[(2S)-1-amino-2-(4,4-dimethylhept-6-enoylamino)-3-methylbutylidene]amino]propanoyl]diazinane-3-carboxylic acid (PubChem CID 163700718) has the molecular formula C22H39N5O4 and a molecular weight of 437.59 g/mol. Its IUPAC name is (3S)-1-[(2S)-2-[[(2S)-1-amino-2-(4,4-dimethylhept-6-enoylamino)-3-methylbutylidene]amino]propanoyl]diazinane-3-carboxylic acid.
| Compound Name | (3S)-1-[(2S)-2-[[(2S)-1-amino-2-(4,4-dimethylhept-6-enoylamino)-3-methylbutylidene]amino]propanoyl]diazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 163700718 |
| Molecular Formula | C22H39N5O4 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | (3S)-1-[(2S)-2-[[(2S)-1-amino-2-(4,4-dimethylhept-6-enoylamino)-3-methylbutylidene]amino]propanoyl]diazinane-3-carboxylic acid |
| SMILES | C=CCC(C)(C)CCC(=O)N[C@H](/C(N)=N/[C@@H](C)C(=O)N1CCC[C@@H](C(=O)O)N1)C(C)C |
| InChI | InChI=1S/C22H39N5O4/c1-7-11-22(5,6)12-10-17(28)25-18(14(2)3)19(23)24-15(4)20(29)27-13-8-9-16(26-27)21(30)31/h7,14-16,18,26H,1,8-13H2,2-6H3,(H2,23,24)(H,25,28)(H,30,31)/t15-,16-,18-/m0/s1 |
| InChIKey | KATAXUKVLLQRKG-BQFCYCMXSA-N |
| XLogP | 1.84 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|