C19H30O4 — CID 163558920
2-[5-[(4-cyclohexylcyclohexen-1-yl)-hydroxymethyl]oxolan-2-yl]acetic acid (PubChem CID 163558920) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[5-[(4-cyclohexylcyclohexen-1-yl)-hydroxymethyl]oxolan-2-yl]acetic acid.
| Compound Name | 2-[5-[(4-cyclohexylcyclohexen-1-yl)-hydroxymethyl]oxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 163558920 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-[5-[(4-cyclohexylcyclohexen-1-yl)-hydroxymethyl]oxolan-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCC(C(O)C2=CCC(C3CCCCC3)CC2)O1 |
| InChI | InChI=1S/C19H30O4/c20-18(21)12-16-10-11-17(23-16)19(22)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h8,13-14,16-17,19,22H,1-7,9-12H2,(H,20,21) |
| InChIKey | FPMSLMVPZMQHTN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|