C24H30N5O3S- — CID 163559677
[5-[methyl(oxan-4-yl)amino]-1,3-thiazol-2-yl]-[1-[4-(prop-2-enoylamino)benzoyl]piperidin-3-yl]azanide (PubChem CID 163559677) has the molecular formula C24H30N5O3S- and a molecular weight of 468.60 g/mol. Its IUPAC name is [5-[methyl(oxan-4-yl)amino]-1,3-thiazol-2-yl]-[1-[4-(prop-2-enoylamino)benzoyl]piperidin-3-yl]azanide.
| Compound Name | [5-[methyl(oxan-4-yl)amino]-1,3-thiazol-2-yl]-[1-[4-(prop-2-enoylamino)benzoyl]piperidin-3-yl]azanide |
|---|---|
| PubChem CID | 163559677 |
| Molecular Formula | C24H30N5O3S- |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | [5-[methyl(oxan-4-yl)amino]-1,3-thiazol-2-yl]-[1-[4-(prop-2-enoylamino)benzoyl]piperidin-3-yl]azanide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCCC([N-]c3ncc(N(C)C4CCOCC4)s3)C2)cc1 |
| InChI | InChI=1S/C24H31N5O3S/c1-3-21(30)26-18-8-6-17(7-9-18)23(31)29-12-4-5-19(16-29)27-24-25-15-22(33-24)28(2)20-10-13-32-14-11-20/h3,6-9,15,19-20H,1,4-5,10-14,16H2,2H3,(H2,25,26,27,30,31)/p-1 |
| InChIKey | FQDMVLYFDYHBQH-UHFFFAOYSA-M |
| XLogP | 4.19 |
| TPSA | 88.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|