C14H22F2O — CID 163560360
(1R,2E,5R)-2-ethylidene-5-fluoro-1-(3-fluorocyclohexen-1-yl)hexan-1-ol (PubChem CID 163560360) has the molecular formula C14H22F2O and a molecular weight of 244.32 g/mol. Its IUPAC name is (1R,2E,5R)-2-ethylidene-5-fluoro-1-(3-fluorocyclohexen-1-yl)hexan-1-ol.
| Compound Name | (1R,2E,5R)-2-ethylidene-5-fluoro-1-(3-fluorocyclohexen-1-yl)hexan-1-ol |
|---|---|
| PubChem CID | 163560360 |
| Molecular Formula | C14H22F2O |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (1R,2E,5R)-2-ethylidene-5-fluoro-1-(3-fluorocyclohexen-1-yl)hexan-1-ol |
| SMILES | C/C=C(\CC[C@@H](C)F)[C@@H](O)C1=CC(F)CCC1 |
| InChI | InChI=1S/C14H22F2O/c1-3-11(8-7-10(2)15)14(17)12-5-4-6-13(16)9-12/h3,9-10,13-14,17H,4-8H2,1-2H3/b11-3+/t10-,13?,14-/m1/s1 |
| InChIKey | FQSIOAURHAAJAN-QQAWIXNSSA-N |
| XLogP | 3.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|