C19H23NO2 — CID 163564541
(2R)-2-methyl-4-[4-[(3-methylphenyl)methoxy]phenyl]butanamide (PubChem CID 163564541) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2R)-2-methyl-4-[4-[(3-methylphenyl)methoxy]phenyl]butanamide.
| Compound Name | (2R)-2-methyl-4-[4-[(3-methylphenyl)methoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 163564541 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2R)-2-methyl-4-[4-[(3-methylphenyl)methoxy]phenyl]butanamide |
| SMILES | Cc1cccc(COc2ccc(CC[C@@H](C)C(N)=O)cc2)c1 |
| InChI | InChI=1S/C19H23NO2/c1-14-4-3-5-17(12-14)13-22-18-10-8-16(9-11-18)7-6-15(2)19(20)21/h3-5,8-12,15H,6-7,13H2,1-2H3,(H2,20,21)/t15-/m1/s1 |
| InChIKey | INHOBLITVRRKOM-OAHLLOKOSA-N |
| XLogP | 3.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |