C8H10NS+ — CID 163565071
(6-methylidene-3-methyliminocyclohexa-1,4-dien-1-yl)sulfanium (PubChem CID 163565071) has the molecular formula C8H10NS+ and a molecular weight of 152.24 g/mol. Its IUPAC name is (6-methylidene-3-methyliminocyclohexa-1,4-dien-1-yl)sulfanium.
| Compound Name | (6-methylidene-3-methyliminocyclohexa-1,4-dien-1-yl)sulfanium |
|---|---|
| PubChem CID | 163565071 |
| Molecular Formula | C8H10NS+ |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | (6-methylidene-3-methyliminocyclohexa-1,4-dien-1-yl)sulfanium |
| SMILES | C=C1C=C/C(=N\C)C=C1[SH2+] |
| InChI | InChI=1S/C8H9NS/c1-6-3-4-7(9-2)5-8(6)10/h3-5,10H,1H2,2H3/p+1/b9-7+ |
| InChIKey | FUMQMUBTPRRAPG-VQHVLOKHSA-O |
| XLogP | 1.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|