About tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate
tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate (PubChem CID 163566033) has the molecular formula C14H27IO2
and a molecular weight of 354.27 g/mol. Its IUPAC name is tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate.
Molecular Properties
| Compound Name | tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate |
| PubChem CID | 163566033 |
| Molecular Formula | C14H27IO2 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate |
| SMILES | CI(CCC1CCCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27IO2/c1-14(2,3)17-13(16)15(4)11-10-12-8-6-5-7-9-12/h12H,5-11H2,1-4H3 |
| InChIKey | FVGOVNQZESOBDU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate?
The IUPAC name of tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate (CID 163566033) is tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate.
What is the SMILES notation for tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate?
The canonical SMILES for tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate is CI(CCC1CCCCC1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate?
The InChIKey is FVGOVNQZESOBDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27IO2/c1-14(2,3)17-13(16)15(4)11-10-12-8-6-5-7-9-12/h12H,5-11H2,1-4H3.
What are the key properties of tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate?
tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate has a molecular weight of 354.27 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [2-cyclohexylethyl(methyl)-λ3-iodanyl]formate is sourced from PubChem (CID 163566033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).