C20H23F2NO — CID 163567407
2-(4-tert-butylphenyl)-2-[1-(2,6-difluorophenyl)ethylideneamino]ethanol (PubChem CID 163567407) has the molecular formula C20H23F2NO and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2-[1-(2,6-difluorophenyl)ethylideneamino]ethanol.
| Compound Name | 2-(4-tert-butylphenyl)-2-[1-(2,6-difluorophenyl)ethylideneamino]ethanol |
|---|---|
| PubChem CID | 163567407 |
| Molecular Formula | C20H23F2NO |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2-[1-(2,6-difluorophenyl)ethylideneamino]ethanol |
| SMILES | C/C(=N\C(CO)c1ccc(C(C)(C)C)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C20H23F2NO/c1-13(19-16(21)6-5-7-17(19)22)23-18(12-24)14-8-10-15(11-9-14)20(2,3)4/h5-11,18,24H,12H2,1-4H3/b23-13+ |
| InChIKey | FWJUBBRNNGWHAK-YDZHTSKRSA-N |
| XLogP | 4.80 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|