C18H29N6O3+ — CID 163567787
4-[acetyl-[2-[(2-amino-2-oxoethyl)-benzylamino]-2-oxoethyl]amino]butyl-(diaminomethylidene)azanium (PubChem CID 163567787) has the molecular formula C18H29N6O3+ and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-[acetyl-[2-[(2-amino-2-oxoethyl)-benzylamino]-2-oxoethyl]amino]butyl-(diaminomethylidene)azanium.
| Compound Name | 4-[acetyl-[2-[(2-amino-2-oxoethyl)-benzylamino]-2-oxoethyl]amino]butyl-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 163567787 |
| Molecular Formula | C18H29N6O3+ |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 4-[acetyl-[2-[(2-amino-2-oxoethyl)-benzylamino]-2-oxoethyl]amino]butyl-(diaminomethylidene)azanium |
| SMILES | CC(=O)N(CCCC[NH+]=C(N)N)CC(=O)N(CC(N)=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H28N6O3/c1-14(25)23(10-6-5-9-22-18(20)21)13-17(27)24(12-16(19)26)11-15-7-3-2-4-8-15/h2-4,7-8H,5-6,9-13H2,1H3,(H2,19,26)(H4,20,21,22)/p+1 |
| InChIKey | FWRGNHJRGMTIIU-UHFFFAOYSA-O |
| XLogP | -2.52 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|