C24H30N4O — CID 163570866
amino-[2-methyl-8-(2,4,6-trimethylphenyl)-4,5,6,7-tetrahydropyrazolo[3,4-b]azepin-3-yl]-phenylmethanol (PubChem CID 163570866) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is amino-[2-methyl-8-(2,4,6-trimethylphenyl)-4,5,6,7-tetrahydropyrazolo[3,4-b]azepin-3-yl]-phenylmethanol.
| Compound Name | amino-[2-methyl-8-(2,4,6-trimethylphenyl)-4,5,6,7-tetrahydropyrazolo[3,4-b]azepin-3-yl]-phenylmethanol |
|---|---|
| PubChem CID | 163570866 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | amino-[2-methyl-8-(2,4,6-trimethylphenyl)-4,5,6,7-tetrahydropyrazolo[3,4-b]azepin-3-yl]-phenylmethanol |
| SMILES | Cc1cc(C)c(N2CCCCc3c2nn(C)c3C(N)(O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H30N4O/c1-16-14-17(2)21(18(3)15-16)28-13-9-8-12-20-22(27(4)26-23(20)28)24(25,29)19-10-6-5-7-11-19/h5-7,10-11,14-15,29H,8-9,12-13,25H2,1-4H3 |
| InChIKey | FZFPRWXWGXDHPJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|