C7H12NO+ — CID 163572064
(6-amino-3-methylcyclohexa-1,3-dien-1-yl)oxidanium (PubChem CID 163572064) has the molecular formula C7H12NO+ and a molecular weight of 126.18 g/mol. Its IUPAC name is (6-amino-3-methylcyclohexa-1,3-dien-1-yl)oxidanium.
| Compound Name | (6-amino-3-methylcyclohexa-1,3-dien-1-yl)oxidanium |
|---|---|
| PubChem CID | 163572064 |
| Molecular Formula | C7H12NO+ |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | (6-amino-3-methylcyclohexa-1,3-dien-1-yl)oxidanium |
| SMILES | CC1=CCC(N)C([OH2+])=C1 |
| InChI | InChI=1S/C7H11NO/c1-5-2-3-6(8)7(9)4-5/h2,4,6,9H,3,8H2,1H3/p+1 |
| InChIKey | GAFSZESZYDQOJI-UHFFFAOYSA-O |
| XLogP | 0.27 |
| TPSA | 48.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|