C15H27NO — CID 143356830
(E)-1-(6-amino-4-propan-2-ylcyclohexa-2,4-dien-1-yl)but-1-en-1-ol;ethane (PubChem CID 143356830) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (E)-1-(6-amino-4-propan-2-ylcyclohexa-2,4-dien-1-yl)but-1-en-1-ol;ethane.
| Compound Name | (E)-1-(6-amino-4-propan-2-ylcyclohexa-2,4-dien-1-yl)but-1-en-1-ol;ethane |
|---|---|
| PubChem CID | 143356830 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (E)-1-(6-amino-4-propan-2-ylcyclohexa-2,4-dien-1-yl)but-1-en-1-ol;ethane |
| SMILES | CC.CC/C=C(/O)C1C=CC(C(C)C)=CC1N |
| InChI | InChI=1S/C13H21NO.C2H6/c1-4-5-13(15)11-7-6-10(9(2)3)8-12(11)14;1-2/h5-9,11-12,15H,4,14H2,1-3H3;1-2H3/b13-5+; |
| InChIKey | VZFWDGRDGGVTFX-CMZQJCRFSA-N |
| XLogP | 3.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|