C13H21NO — CID 143356831
(E)-1-(6-amino-4-propan-2-ylcyclohexa-2,4-dien-1-yl)but-1-en-1-ol (PubChem CID 143356831) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (E)-1-(6-amino-4-propan-2-ylcyclohexa-2,4-dien-1-yl)but-1-en-1-ol.
| Compound Name | (E)-1-(6-amino-4-propan-2-ylcyclohexa-2,4-dien-1-yl)but-1-en-1-ol |
|---|---|
| PubChem CID | 143356831 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (E)-1-(6-amino-4-propan-2-ylcyclohexa-2,4-dien-1-yl)but-1-en-1-ol |
| SMILES | CC/C=C(/O)C1C=CC(C(C)C)=CC1N |
| InChI | InChI=1S/C13H21NO/c1-4-5-13(15)11-7-6-10(9(2)3)8-12(11)14/h5-9,11-12,15H,4,14H2,1-3H3/b13-5+ |
| InChIKey | MPNUBJRDVUZMLQ-WLRTZDKTSA-N |
| XLogP | 2.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|