C10H12BrFN3O4+ — CID 163575442
(1R,3R,4R,5S)-4'-amino-3-(bromomethyl)-5-fluoro-4-hydroxy-3-(hydroxymethyl)spiro[2-oxa-6-azoniabicyclo[3.1.0]hexane-6,1'-pyrimidin-1-ium]-2'-one (PubChem CID 163575442) has the molecular formula C10H12BrFN3O4+ and a molecular weight of 337.13 g/mol. Its IUPAC name is (1R,3R,4R,5S)-4'-amino-3-(bromomethyl)-5-fluoro-4-hydroxy-3-(hydroxymethyl)spiro[2-oxa-6-azoniabicyclo[3.1.0]hexane-6,1'-pyrimidin-1-ium]-2'-one.
| Compound Name | (1R,3R,4R,5S)-4'-amino-3-(bromomethyl)-5-fluoro-4-hydroxy-3-(hydroxymethyl)spiro[2-oxa-6-azoniabicyclo[3.1.0]hexane-6,1'-pyrimidin-1-ium]-2'-one |
|---|---|
| PubChem CID | 163575442 |
| Molecular Formula | C10H12BrFN3O4+ |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (1R,3R,4R,5S)-4'-amino-3-(bromomethyl)-5-fluoro-4-hydroxy-3-(hydroxymethyl)spiro[2-oxa-6-azoniabicyclo[3.1.0]hexane-6,1'-pyrimidin-1-ium]-2'-one |
| SMILES | NC1=NC(=O)[N+]2(C=C1)[C@@H]1O[C@@](CO)(CBr)[C@@H](O)[C@]12F |
| InChI | InChI=1S/C10H11BrFN3O4/c11-3-9(4-16)6(17)10(12)7(19-9)15(10)2-1-5(13)14-8(15)18/h1-2,6-7,16-17H,3-4H2,(H-,13,14,18)/p+1/t6-,7-,9-,10-,15?/m1/s1 |
| InChIKey | FFMTVRFDHOKLFL-WTSFWLGQSA-O |
| XLogP | -0.67 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|