C12H17FN3O4+ — CID 147650638
(1R,3R,4R,5S)-5-fluoro-4-hydroxy-3-(hydroxymethyl)-4'-imino-3-propylspiro[2-oxa-6-azoniabicyclo[3.1.0]hexane-6,1'-pyrimidin-1-ium]-2'-one (PubChem CID 147650638) has the molecular formula C12H17FN3O4+ and a molecular weight of 286.28 g/mol. Its IUPAC name is (1R,3R,4R,5S)-5-fluoro-4-hydroxy-3-(hydroxymethyl)-4'-imino-3-propylspiro[2-oxa-6-azoniabicyclo[3.1.0]hexane-6,1'-pyrimidin-1-ium]-2'-one.
| Compound Name | (1R,3R,4R,5S)-5-fluoro-4-hydroxy-3-(hydroxymethyl)-4'-imino-3-propylspiro[2-oxa-6-azoniabicyclo[3.1.0]hexane-6,1'-pyrimidin-1-ium]-2'-one |
|---|---|
| PubChem CID | 147650638 |
| Molecular Formula | C12H17FN3O4+ |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (1R,3R,4R,5S)-5-fluoro-4-hydroxy-3-(hydroxymethyl)-4'-imino-3-propylspiro[2-oxa-6-azoniabicyclo[3.1.0]hexane-6,1'-pyrimidin-1-ium]-2'-one |
| SMILES | [H]/N=C1\C=C[N+]2(C(=O)N1)[C@@H]1O[C@@](CO)(CCC)[C@@H](O)[C@]12F |
| InChI | InChI=1S/C12H16FN3O4/c1-2-4-11(6-17)8(18)12(13)9(20-11)16(12)5-3-7(14)15-10(16)19/h3,5,8-9,17-18H,2,4,6H2,1H3,(H-,14,15,19)/p+1/t8-,9-,11-,12-,16?/m1/s1 |
| InChIKey | WVWXLJQUFJVNIY-NYNCAIRASA-O |
| XLogP | -0.05 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|