C7H13N3O3 — CID 176684581
4,5-bis(hydroxymethyl)-6-imino-5-methyl-1,3-diazinan-2-one (PubChem CID 176684581) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-6-imino-5-methyl-1,3-diazinan-2-one.
| Compound Name | 4,5-bis(hydroxymethyl)-6-imino-5-methyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 176684581 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-6-imino-5-methyl-1,3-diazinan-2-one |
| SMILES | [H]/N=C1\NC(=O)NC(CO)C1(C)CO |
| InChI | InChI=1S/C7H13N3O3/c1-7(3-12)4(2-11)9-6(13)10-5(7)8/h4,11-12H,2-3H2,1H3,(H3,8,9,10,13) |
| InChIKey | RWPMHFZVYLWWIJ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|