C11H13N3O — CID 138389193
4-imino-5-(1-phenylethyl)imidazolidin-2-one (PubChem CID 138389193) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-imino-5-(1-phenylethyl)imidazolidin-2-one.
| Compound Name | 4-imino-5-(1-phenylethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 138389193 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-imino-5-(1-phenylethyl)imidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)NC1C(C)c1ccccc1 |
| InChI | InChI=1S/C11H13N3O/c1-7(8-5-3-2-4-6-8)9-10(12)14-11(15)13-9/h2-7,9H,1H3,(H3,12,13,14,15) |
| InChIKey | MNLDBZCMQZWPTR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|