C11H11NO2S — CID 101057113
5-(1-phenylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 101057113) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 5-(1-phenylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(1-phenylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 101057113 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 5-(1-phenylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CC(c1ccccc1)C1SC(=O)NC1=O |
| InChI | InChI=1S/C11H11NO2S/c1-7(8-5-3-2-4-6-8)9-10(13)12-11(14)15-9/h2-7,9H,1H3,(H,12,13,14) |
| InChIKey | GXUWYJSUGYEMSU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|