C15H14N2O4S — CID 87066059
5-[1-(8-methoxy-2-oxo-1H-quinolin-5-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 87066059) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is 5-[1-(8-methoxy-2-oxo-1H-quinolin-5-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[1-(8-methoxy-2-oxo-1H-quinolin-5-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87066059 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 5-[1-(8-methoxy-2-oxo-1H-quinolin-5-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C(C)C2SC(=O)NC2=O)c2ccc(=O)[nH]c12 |
| InChI | InChI=1S/C15H14N2O4S/c1-7(13-14(19)17-15(20)22-13)8-3-5-10(21-2)12-9(8)4-6-11(18)16-12/h3-7,13H,1-2H3,(H,16,18)(H,17,19,20) |
| InChIKey | OQVJDSFFLSIURM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|