C8H9NO2S — CID 118187718
5-[(2S)-pent-4-yn-2-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 118187718) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 5-[(2S)-pent-4-yn-2-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(2S)-pent-4-yn-2-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118187718 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 5-[(2S)-pent-4-yn-2-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | C#CC[C@H](C)C1SC(=O)NC1=O |
| InChI | InChI=1S/C8H9NO2S/c1-3-4-5(2)6-7(10)9-8(11)12-6/h1,5-6H,4H2,2H3,(H,9,10,11)/t5-,6?/m0/s1 |
| InChIKey | IXCSMDABRLDPCP-ZBHICJROSA-N |
| XLogP | 1.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|