C12H19N3O4 — CID 169190428
1-[(2R,3S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3,5-dimethyloxolan-2-yl]-5-imino-2H-1,4-diazepin-3-one (PubChem CID 169190428) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3,5-dimethyloxolan-2-yl]-5-imino-2H-1,4-diazepin-3-one.
| Compound Name | 1-[(2R,3S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3,5-dimethyloxolan-2-yl]-5-imino-2H-1,4-diazepin-3-one |
|---|---|
| PubChem CID | 169190428 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3,5-dimethyloxolan-2-yl]-5-imino-2H-1,4-diazepin-3-one |
| SMILES | [H]/N=C1\C=CN([C@@H]2O[C@](C)(CO)[C@@H](O)[C@@H]2C)CC(=O)N1 |
| InChI | InChI=1S/C12H19N3O4/c1-7-10(18)12(2,6-16)19-11(7)15-4-3-8(13)14-9(17)5-15/h3-4,7,10-11,16,18H,5-6H2,1-2H3,(H2,13,14,17)/t7-,10-,11+,12+/m0/s1 |
| InChIKey | NRPFPBHQUJQMBA-CWPPHPDTSA-N |
| XLogP | -0.99 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|