C13H17N5O5 — CID 135976404
7-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-5-carboximidamide (PubChem CID 135976404) has the molecular formula C13H17N5O5 and a molecular weight of 323.31 g/mol. Its IUPAC name is 7-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-5-carboximidamide.
| Compound Name | 7-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 135976404 |
| Molecular Formula | C13H17N5O5 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 7-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-4-oxo-3H-pyrrolo[2,3-d]pyrimidine-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cn(C2O[C@](C)(CO)[C@@H](O)[C@H]2O)c2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C13H17N5O5/c1-13(3-19)8(21)7(20)12(23-13)18-2-5(9(14)15)6-10(18)16-4-17-11(6)22/h2,4,7-8,12,19-21H,3H2,1H3,(H3,14,15)(H,16,17,22)/t7-,8+,12?,13-/m1/s1 |
| InChIKey | XOBGWTHSCITRLB-HSUMWKLJSA-N |
| XLogP | -1.99 |
| TPSA | 170.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|