C9H12N2O3S — CID 166046741
3-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-6-imino-3H-pyridin-2-one (PubChem CID 166046741) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 3-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-6-imino-3H-pyridin-2-one.
| Compound Name | 3-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-6-imino-3H-pyridin-2-one |
|---|---|
| PubChem CID | 166046741 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-6-imino-3H-pyridin-2-one |
| SMILES | [H]/N=C1\C=CC([C@@H]2CS[C@H](CO)O2)C(=O)N1 |
| InChI | InChI=1S/C9H12N2O3S/c10-7-2-1-5(9(13)11-7)6-4-15-8(3-12)14-6/h1-2,5-6,8,12H,3-4H2,(H2,10,11,13)/t5?,6-,8+/m0/s1 |
| InChIKey | RJASBFKPKAEBFM-KVWYPCGYSA-N |
| XLogP | -0.28 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|