C12H15NO5 — CID 24883911
5-ethenyl-3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyridine-2,6-dione (PubChem CID 24883911) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 5-ethenyl-3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyridine-2,6-dione.
| Compound Name | 5-ethenyl-3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 24883911 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-ethenyl-3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-pyridine-2,6-dione |
| SMILES | C=CC1=CC([C@@H]2C[C@H](O)[C@@H](CO)O2)C(=O)NC1=O |
| InChI | InChI=1S/C12H15NO5/c1-2-6-3-7(12(17)13-11(6)16)9-4-8(15)10(5-14)18-9/h2-3,7-10,14-15H,1,4-5H2,(H,13,16,17)/t7?,8-,9-,10+/m0/s1 |
| InChIKey | UOUPFZWNLPIJCH-JVSARINNSA-N |
| XLogP | -1.12 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|