C10H13N2O5+ — CID 102431465
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylidenepyrimidin-1-ium-2,4-dione (PubChem CID 102431465) has the molecular formula C10H13N2O5+ and a molecular weight of 241.22 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylidenepyrimidin-1-ium-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylidenepyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 102431465 |
| Molecular Formula | C10H13N2O5+ |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylidenepyrimidin-1-ium-2,4-dione |
| SMILES | C=C1C=[N+]([C@H]2C[C@H](O)[C@@H](CO)O2)C(=O)NC1=O |
| InChI | InChI=1S/C10H12N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,1-2,4H2/p+1/t6-,7+,8+/m0/s1 |
| InChIKey | QYGZSPYLMFYJAL-XLPZGREQSA-O |
| XLogP | -1.66 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|