C11H15N4O3+ — CID 90927662
(2R,3S)-2-(hydroxymethyl)-5-(8-methyl-7H-purin-1-ium-1-yl)oxolan-3-ol (PubChem CID 90927662) has the molecular formula C11H15N4O3+ and a molecular weight of 251.27 g/mol. Its IUPAC name is (2R,3S)-2-(hydroxymethyl)-5-(8-methyl-7H-purin-1-ium-1-yl)oxolan-3-ol.
| Compound Name | (2R,3S)-2-(hydroxymethyl)-5-(8-methyl-7H-purin-1-ium-1-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 90927662 |
| Molecular Formula | C11H15N4O3+ |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (2R,3S)-2-(hydroxymethyl)-5-(8-methyl-7H-purin-1-ium-1-yl)oxolan-3-ol |
| SMILES | Cc1nc2nc[n+](C3C[C@H](O)[C@@H](CO)O3)cc2[nH]1 |
| InChI | InChI=1S/C11H14N4O3/c1-6-13-7-3-15(5-12-11(7)14-6)10-2-8(17)9(4-16)18-10/h3,5,8-10,16-17H,2,4H2,1H3/p+1/t8-,9+,10?/m0/s1 |
| InChIKey | NMGJKSCKCMYPSB-QIIDTADFSA-O |
| XLogP | -0.81 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|