C11H15FN5O3+ — CID 91598636
(2R,3S)-5-[2-fluoro-8-(methylamino)-7H-purin-1-ium-1-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 91598636) has the molecular formula C11H15FN5O3+ and a molecular weight of 284.27 g/mol. Its IUPAC name is (2R,3S)-5-[2-fluoro-8-(methylamino)-7H-purin-1-ium-1-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S)-5-[2-fluoro-8-(methylamino)-7H-purin-1-ium-1-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 91598636 |
| Molecular Formula | C11H15FN5O3+ |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2R,3S)-5-[2-fluoro-8-(methylamino)-7H-purin-1-ium-1-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CNc1nc2nc(F)[n+](C3C[C@H](O)[C@@H](CO)O3)cc2[nH]1 |
| InChI | InChI=1S/C11H14FN5O3/c1-13-11-14-5-3-17(10(12)15-9(5)16-11)8-2-6(19)7(4-18)20-8/h3,6-8,18-19H,2,4H2,1H3,(H,13,14)/p+1/t6-,7+,8?/m0/s1 |
| InChIKey | IRMZBVIBWPJXNX-KJFJCRTCSA-O |
| XLogP | -0.93 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|