C14H20N5O6+ — CID 136768584
2-[2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-9-ium-7-yl]ethyl acetate (PubChem CID 136768584) has the molecular formula C14H20N5O6+ and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-[2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-9-ium-7-yl]ethyl acetate.
| Compound Name | 2-[2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-9-ium-7-yl]ethyl acetate |
|---|---|
| PubChem CID | 136768584 |
| Molecular Formula | C14H20N5O6+ |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-[2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-9-ium-7-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1c[n+]([C@H]2C[C@H](O)[C@@H](CO)O2)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C14H19N5O6/c1-7(21)24-3-2-18-6-19(10-4-8(22)9(5-20)25-10)12-11(18)13(23)17-14(15)16-12/h6,8-10,20,22H,2-5H2,1H3,(H2-,15,16,17,23)/p+1/t8-,9+,10+/m0/s1 |
| InChIKey | UDSALKWJBGXRQV-IVZWLZJFSA-O |
| XLogP | -2.20 |
| TPSA | 156.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|