C11H18N5O9P2S+ — CID 137279691
[(2R,3S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydroxyphosphinothioyl hydrogen phosphate (PubChem CID 137279691) has the molecular formula C11H18N5O9P2S+ and a molecular weight of 458.31 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydroxyphosphinothioyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydroxyphosphinothioyl hydrogen phosphate |
|---|---|
| PubChem CID | 137279691 |
| Molecular Formula | C11H18N5O9P2S+ |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | [(2R,3S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydroxyphosphinothioyl hydrogen phosphate |
| SMILES | Cn1c[n+]([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(O)(O)=S)O2)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C11H17N5O9P2S/c1-15-4-16(9-8(15)10(18)14-11(12)13-9)7-2-5(17)6(24-7)3-23-26(19,20)25-27(21,22)28/h4-7,17H,2-3H2,1H3,(H5-,12,13,14,18,19,20,21,22,28)/p+1/t5-,6+,7+/m0/s1 |
| InChIKey | TUBHHOFQRKSMOK-RRKCRQDMSA-O |
| XLogP | -1.88 |
| TPSA | 206.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|