C11H18N5O8P2+ — CID 135566448
[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphanyl hydrogen phosphate (PubChem CID 135566448) has the molecular formula C11H18N5O8P2+ and a molecular weight of 410.24 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphanyl hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphanyl hydrogen phosphate |
|---|---|
| PubChem CID | 135566448 |
| Molecular Formula | C11H18N5O8P2+ |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphanyl hydrogen phosphate |
| SMILES | Cn1c[n+]([C@@H]2O[C@H](COP(=O)(O)OP)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C11H17N5O8P2/c1-15-3-16(8-5(15)9(19)14-11(12)13-8)10-7(18)6(17)4(23-10)2-22-26(20,21)24-25/h3-4,6-7,10,17-18H,2,25H2,1H3,(H3-,12,13,14,19,20,21)/p+1/t4-,6-,7-,10-/m1/s1 |
| InChIKey | XGTPPQQALVYBSG-KQYNXXCUSA-O |
| XLogP | -2.33 |
| TPSA | 186.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|