C11H18N6O7P+ — CID 164575475
[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidic acid (PubChem CID 164575475) has the molecular formula C11H18N6O7P+ and a molecular weight of 377.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidic acid |
|---|---|
| PubChem CID | 164575475 |
| Molecular Formula | C11H18N6O7P+ |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidic acid |
| SMILES | Cn1c[n+]([C@@H]2O[C@H](COP(N)(=O)O)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C11H17N6O7P/c1-16-3-17(8-5(16)9(20)15-11(12)14-8)10-7(19)6(18)4(24-10)2-23-25(13,21)22/h3-4,6-7,10,18-19H,2H2,1H3,(H5-,12,13,14,15,20,21,22)/p+1/t4-,6-,7-,10-/m1/s1 |
| InChIKey | WMNAJOAETIECPK-KQYNXXCUSA-O |
| XLogP | -3.17 |
| TPSA | 202.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|