C11H15IN5O4+ — CID 147479551
2-amino-9-[(2R,3S,5S)-3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one (PubChem CID 147479551) has the molecular formula C11H15IN5O4+ and a molecular weight of 408.18 g/mol. Its IUPAC name is 2-amino-9-[(2R,3S,5S)-3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one.
| Compound Name | 2-amino-9-[(2R,3S,5S)-3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 147479551 |
| Molecular Formula | C11H15IN5O4+ |
| Molecular Weight | 408.18 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 2-amino-9-[(2R,3S,5S)-3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-7-methyl-1H-purin-9-ium-6-one |
| SMILES | Cn1c[n+]([C@@H]2O[C@H](CI)C(O)[C@@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C11H14IN5O4/c1-16-3-17(8-5(16)9(20)15-11(13)14-8)10-7(19)6(18)4(2-12)21-10/h3-4,6-7,10,18-19H,2H2,1H3,(H2-,13,14,15,20)/p+1/t4-,6?,7+,10-/m1/s1 |
| InChIKey | FDJBKNLPBAUTFZ-HMEJCUHCSA-O |
| XLogP | -1.81 |
| TPSA | 130.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.18 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|