C11H18N5O10P2+ — CID 136825798
[[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphaniumyl] dihydrogen phosphate (PubChem CID 136825798) has the molecular formula C11H18N5O10P2+ and a molecular weight of 442.24 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphaniumyl] dihydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphaniumyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 136825798 |
| Molecular Formula | C11H18N5O10P2+ |
| Molecular Weight | 442.24 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphaniumyl] dihydrogen phosphate |
| SMILES | Cn1c[n+]([C@@H]2O[C@H](CO[PH+]([O-])OP(=O)(O)O)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C11H17N5O10P2/c1-15-3-16(8-5(15)9(19)14-11(12)13-8)10-7(18)6(17)4(25-10)2-24-27(20)26-28(21,22)23/h3-4,6-7,10,17-18,27H,2H2,1H3,(H4-,12,13,14,19,21,22,23)/p+1/t4-,6-,7-,10-/m1/s1 |
| InChIKey | AIOJENWECLAYNQ-KQYNXXCUSA-O |
| XLogP | -3.80 |
| TPSA | 229.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.24 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|