C13H16N5O10P2- — CID 153452605
[[(2R,4S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-ethynylphosphinate (PubChem CID 153452605) has the molecular formula C13H16N5O10P2- and a molecular weight of 464.24 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-ethynylphosphinate.
| Compound Name | [[(2R,4S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-ethynylphosphinate |
|---|---|
| PubChem CID | 153452605 |
| Molecular Formula | C13H16N5O10P2- |
| Molecular Weight | 464.24 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | [[(2R,4S,5R)-5-(2-amino-7-methyl-6-oxo-1H-purin-9-ium-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-ethynylphosphinate |
| SMILES | C#CP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)[C@@H](O)C1O |
| InChI | InChI=1S/C13H17N5O10P2/c1-3-29(22,23)28-30(24,25)26-4-6-8(19)9(20)12(27-6)18-5-17(2)7-10(18)15-13(14)16-11(7)21/h1,5-6,8-9,12,19-20H,4H2,2H3,(H4-,14,15,16,21,22,23,24,25)/p-1/t6-,8?,9+,12-/m1/s1 |
| InChIKey | ZLPZCXBFTXQQTL-WURNFRPNSA-M |
| XLogP | -3.60 |
| TPSA | 228.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.24 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|